C22H17F12NO — CID 138485362
bis[3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-methylpyrrolidin-2-yl]methanol (PubChem CID 138485362) has the molecular formula C22H17F12NO and a molecular weight of 539.36 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-methylpyrrolidin-2-yl]methanol.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-methylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 138485362 |
| Molecular Formula | C22H17F12NO |
| Molecular Weight | 539.36 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-methylpyrrolidin-2-yl]methanol |
| SMILES | C[C@]1(C(O)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCCN1 |
| InChI | InChI=1S/C22H17F12NO/c1-17(3-2-4-35-17)18(36,11-5-13(19(23,24)25)9-14(6-11)20(26,27)28)12-7-15(21(29,30)31)10-16(8-12)22(32,33)34/h5-10,35-36H,2-4H2,1H3/t17-/m1/s1 |
| InChIKey | NACSDWNHKIGGBG-QGZVFWFLSA-N |
| XLogP | 7.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.36 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |