C19H22F3N5O — CID 138485940
1-cyclohexyl-N-[(2E,4E)-5-(trifluoromethoxy)hepta-2,4,6-trien-2-yl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 138485940) has the molecular formula C19H22F3N5O and a molecular weight of 393.41 g/mol. Its IUPAC name is 1-cyclohexyl-N-[(2E,4E)-5-(trifluoromethoxy)hepta-2,4,6-trien-2-yl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-cyclohexyl-N-[(2E,4E)-5-(trifluoromethoxy)hepta-2,4,6-trien-2-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 138485940 |
| Molecular Formula | C19H22F3N5O |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 1-cyclohexyl-N-[(2E,4E)-5-(trifluoromethoxy)hepta-2,4,6-trien-2-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | C=C/C(=C\C=C(/C)Nc1ncnc2c1cnn2C1CCCCC1)OC(F)(F)F |
| InChI | InChI=1S/C19H22F3N5O/c1-3-15(28-19(20,21)22)10-9-13(2)26-17-16-11-25-27(18(16)24-12-23-17)14-7-5-4-6-8-14/h3,9-12,14H,1,4-8H2,2H3,(H,23,24,26)/b13-9+,15-10+ |
| InChIKey | UWJLGBWBWLDSRQ-XHWVFBAXSA-N |
| XLogP | 5.25 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|