C29H33FN4O6S — CID 138486045
S-[(E)-4-[(4Z,7S,10S)-7-benzyl-4-ethylidene-18-fluoro-8-hydroxy-2,5,12-trioxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate (PubChem CID 138486045) has the molecular formula C29H33FN4O6S and a molecular weight of 584.67 g/mol. Its IUPAC name is S-[(E)-4-[(4Z,7S,10S)-7-benzyl-4-ethylidene-18-fluoro-8-hydroxy-2,5,12-trioxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate.
| Compound Name | S-[(E)-4-[(4Z,7S,10S)-7-benzyl-4-ethylidene-18-fluoro-8-hydroxy-2,5,12-trioxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 138486045 |
| Molecular Formula | C29H33FN4O6S |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | S-[(E)-4-[(4Z,7S,10S)-7-benzyl-4-ethylidene-18-fluoro-8-hydroxy-2,5,12-trioxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate |
| SMILES | C/C=C1\NC(=O)c2nc(ccc2F)CNC(=O)C[C@@H](/C=C/CCSC(C)=O)OC(O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C29H33FN4O6S/c1-3-23-27(37)34-24(15-19-9-5-4-6-10-19)29(39)40-21(11-7-8-14-41-18(2)35)16-25(36)31-17-20-12-13-22(30)26(32-20)28(38)33-23/h3-7,9-13,21,24,29,39H,8,14-17H2,1-2H3,(H,31,36)(H,33,38)(H,34,37)/b11-7+,23-3-/t21-,24+,29?/m1/s1 |
| InChIKey | SVBWJOWKLOIJCS-TVHOFSFZSA-N |
| XLogP | 2.53 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|