C27H50O4 — CID 138486306
[(5Z,8Z)-10-methoxy-2,4-dimethylundeca-5,8-dien-2-yl] (2-methyl-4-propyloctan-3-yl) carbonate (PubChem CID 138486306) has the molecular formula C27H50O4 and a molecular weight of 438.69 g/mol. Its IUPAC name is [(5Z,8Z)-10-methoxy-2,4-dimethylundeca-5,8-dien-2-yl] (2-methyl-4-propyloctan-3-yl) carbonate.
| Compound Name | [(5Z,8Z)-10-methoxy-2,4-dimethylundeca-5,8-dien-2-yl] (2-methyl-4-propyloctan-3-yl) carbonate |
|---|---|
| PubChem CID | 138486306 |
| Molecular Formula | C27H50O4 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | [(5Z,8Z)-10-methoxy-2,4-dimethylundeca-5,8-dien-2-yl] (2-methyl-4-propyloctan-3-yl) carbonate |
| SMILES | CCCCC(CCC)C(OC(=O)OC(C)(C)CC(C)/C=C\C/C=C\C(C)OC)C(C)C |
| InChI | InChI=1S/C27H50O4/c1-10-12-19-24(16-11-2)25(21(3)4)30-26(28)31-27(7,8)20-22(5)17-14-13-15-18-23(6)29-9/h14-15,17-18,21-25H,10-13,16,19-20H2,1-9H3/b17-14-,18-15- |
| InChIKey | IVGIUEQQVXTOQR-UBTQEXSZSA-N |
| XLogP | 8.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|