C26H40O5 — CID 138486365
[(1S,6E,10R,11S,14R,15S)-14-(2-hydroxyacetyl)-7,15-dimethyl-5-oxo-14-tricyclo[8.7.0.011,15]heptadec-6-enyl] pentanoate (PubChem CID 138486365) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is [(1S,6E,10R,11S,14R,15S)-14-(2-hydroxyacetyl)-7,15-dimethyl-5-oxo-14-tricyclo[8.7.0.011,15]heptadec-6-enyl] pentanoate.
| Compound Name | [(1S,6E,10R,11S,14R,15S)-14-(2-hydroxyacetyl)-7,15-dimethyl-5-oxo-14-tricyclo[8.7.0.011,15]heptadec-6-enyl] pentanoate |
|---|---|
| PubChem CID | 138486365 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | [(1S,6E,10R,11S,14R,15S)-14-(2-hydroxyacetyl)-7,15-dimethyl-5-oxo-14-tricyclo[8.7.0.011,15]heptadec-6-enyl] pentanoate |
| SMILES | CCCCC(=O)O[C@]1(C(=O)CO)CC[C@H]2[C@@H]3CC/C(C)=C/C(=O)CCC[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C26H40O5/c1-4-5-9-24(30)31-26(23(29)17-27)15-13-22-21-11-10-18(2)16-20(28)8-6-7-19(21)12-14-25(22,26)3/h16,19,21-22,27H,4-15,17H2,1-3H3/b18-16+/t19-,21+,22-,25-,26-/m0/s1 |
| InChIKey | PVKQUMXYVSARQO-DJKXRQSNSA-N |
| XLogP | 4.94 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |