C24H28FN6O8P — CID 138486537
propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 138486537) has the molecular formula C24H28FN6O8P and a molecular weight of 578.49 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 138486537 |
| Molecular Formula | C24H28FN6O8P |
| Molecular Weight | 578.49 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@@]1(F)O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H28FN6O8P/c1-14(2)37-22(34)15(3)30-40(35,38-16-7-5-4-6-8-16)36-12-24(25)20(33)19(32)23(11-26,39-24)18-10-9-17-21(27)28-13-29-31(17)18/h4-10,13-15,19-20,32-33H,12H2,1-3H3,(H,30,35)(H2,27,28,29)/t15-,19+,20-,23-,24+,40?/m0/s1 |
| InChIKey | HCAYUOOXSCDROE-ZDOKSAILSA-N |
| XLogP | 1.58 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|