C26H32FN6O8P — CID 138486538
2,2-dimethylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 138486538) has the molecular formula C26H32FN6O8P and a molecular weight of 606.55 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 138486538 |
| Molecular Formula | C26H32FN6O8P |
| Molecular Weight | 606.55 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@@]1(F)O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C26H32FN6O8P/c1-16(23(36)38-13-24(2,3)4)32-42(37,40-17-8-6-5-7-9-17)39-14-26(27)21(35)20(34)25(12-28,41-26)19-11-10-18-22(29)30-15-31-33(18)19/h5-11,15-16,20-21,34-35H,13-14H2,1-4H3,(H,32,37)(H2,29,30,31)/t16-,20+,21-,25-,26+,42?/m0/s1 |
| InChIKey | QPYHNFZPDXXJFW-AZLJIRLXSA-N |
| XLogP | 2.22 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|