About (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol
(2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol (PubChem CID 138486623) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol.
Molecular Properties
| Compound Name | (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol |
| PubChem CID | 138486623 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol |
| SMILES | C=C(/C=C(\C)O)n1ccnc1C |
| InChI | InChI=1S/C9H12N2O/c1-7(6-8(2)12)11-5-4-10-9(11)3/h4-6,12H,1H2,2-3H3/b8-6+ |
| InChIKey | KYNFYAREYJXQOV-SOFGYWHQSA-N |
| XLogP | 2.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol?
The IUPAC name of (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol (CID 138486623) is (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol.
What is the SMILES notation for (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol?
The canonical SMILES for (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol is C=C(/C=C(\C)O)n1ccnc1C.
What is the InChIKey of (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol?
The InChIKey is KYNFYAREYJXQOV-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H12N2O/c1-7(6-8(2)12)11-5-4-10-9(11)3/h4-6,12H,1H2,2-3H3/b8-6+.
What are the key properties of (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol?
(2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol has a molecular weight of 164.21 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-(2-methylimidazol-1-yl)penta-2,4-dien-2-ol is sourced from PubChem (CID 138486623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).