C52H33F3N4 — CID 138486679
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[2-(trifluoromethyl)phenyl]phenyl]-2,7-diphenylcarbazole (PubChem CID 138486679) has the molecular formula C52H33F3N4 and a molecular weight of 770.86 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[2-(trifluoromethyl)phenyl]phenyl]-2,7-diphenylcarbazole.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[2-(trifluoromethyl)phenyl]phenyl]-2,7-diphenylcarbazole |
|---|---|
| PubChem CID | 138486679 |
| Molecular Formula | C52H33F3N4 |
| Molecular Weight | 770.86 g/mol |
| Exact Mass | 770.27 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[2-(trifluoromethyl)phenyl]phenyl]-2,7-diphenylcarbazole |
| SMILES | FC(F)(F)c1ccccc1-c1ccc(-n2c3cc(-c4ccccc4)ccc3c3ccc(-c4ccccc4)cc32)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C52H33F3N4/c53-52(54,55)46-24-14-13-23-42(46)41-30-27-40(33-45(41)51-57-49(36-19-9-3-10-20-36)56-50(58-51)37-21-11-4-12-22-37)59-47-31-38(34-15-5-1-6-16-34)25-28-43(47)44-29-26-39(32-48(44)59)35-17-7-2-8-18-35/h1-33H |
| InChIKey | TYOGBIIDHRTPOB-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.86 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |