About 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine
1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine (PubChem CID 138486907) has the molecular formula C9H9ClFN
and a molecular weight of 185.63 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine.
Molecular Properties
| Compound Name | 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine |
| PubChem CID | 138486907 |
| Molecular Formula | C9H9ClFN |
| Molecular Weight | 185.63 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine |
| SMILES | [H]/N=C(\C)C1=C(F)C=C(Cl)CC=C1 |
| InChI | InChI=1S/C9H9ClFN/c1-6(12)8-4-2-3-7(10)5-9(8)11/h2,4-5,12H,3H2,1H3/b12-6+ |
| InChIKey | HSIQSROFCHDMRX-WUXMJOGZSA-N |
| XLogP | 3.33 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine?
The IUPAC name of 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine (CID 138486907) is 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine.
What is the SMILES notation for 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine?
The canonical SMILES for 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine is [H]/N=C(\C)C1=C(F)C=C(Cl)CC=C1.
What is the InChIKey of 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine?
The InChIKey is HSIQSROFCHDMRX-WUXMJOGZSA-N. The full InChI is InChI=1S/C9H9ClFN/c1-6(12)8-4-2-3-7(10)5-9(8)11/h2,4-5,12H,3H2,1H3/b12-6+.
What are the key properties of 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine?
1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine has a molecular weight of 185.63 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-2-fluorocyclohepta-1,3,6-trien-1-yl)ethanimine is sourced from PubChem (CID 138486907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).