About O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine
O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine (PubChem CID 138486996) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine |
| PubChem CID | 138486996 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine |
| SMILES | C/C=C(/C=C/N)ON |
| InChI | InChI=1S/C5H10N2O/c1-2-5(8-7)3-4-6/h2-4H,6-7H2,1H3/b4-3+,5-2- |
| InChIKey | ZGNHSDHHTPOHLY-QSDRKMMISA-N |
| XLogP | 0.25 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine?
The IUPAC name of O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine (CID 138486996) is O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine.
What is the SMILES notation for O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine?
The canonical SMILES for O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine is C/C=C(/C=C/N)ON.
What is the InChIKey of O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine?
The InChIKey is ZGNHSDHHTPOHLY-QSDRKMMISA-N. The full InChI is InChI=1S/C5H10N2O/c1-2-5(8-7)3-4-6/h2-4H,6-7H2,1H3/b4-3+,5-2-.
What are the key properties of O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine?
O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine has a molecular weight of 114.15 g/mol, XLogP of 0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(1E,3Z)-1-aminopenta-1,3-dien-3-yl]hydroxylamine is sourced from PubChem (CID 138486996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).