About (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine
(5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine (PubChem CID 138487197) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine.
Molecular Properties
| Compound Name | (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine |
| PubChem CID | 138487197 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine |
| SMILES | C/C=C1/C=C(C(C)C)\C=N/CCC1 |
| InChI | InChI=1S/C12H19N/c1-4-11-6-5-7-13-9-12(8-11)10(2)3/h4,8-10H,5-7H2,1-3H3/b11-4+,12-8+,13-9- |
| InChIKey | LOPQPYNVJAPIES-VRFFCXROSA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine?
The IUPAC name of (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine (CID 138487197) is (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine.
What is the SMILES notation for (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine?
The canonical SMILES for (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine is C/C=C1/C=C(C(C)C)\C=N/CCC1.
What is the InChIKey of (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine?
The InChIKey is LOPQPYNVJAPIES-VRFFCXROSA-N. The full InChI is InChI=1S/C12H19N/c1-4-11-6-5-7-13-9-12(8-11)10(2)3/h4,8-10H,5-7H2,1-3H3/b11-4+,12-8+,13-9-.
What are the key properties of (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine?
(5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine has a molecular weight of 177.29 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,6Z)-5-ethylidene-7-propan-2-yl-3,4-dihydro-2H-azocine is sourced from PubChem (CID 138487197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).