C17H20ClF3N2O — CID 138487712
N-[1-[(2R,5S)-5-(3-chlorophenyl)-1-prop-2-enylpyrrolidin-2-yl]-2,2,2-trifluoroethyl]acetamide (PubChem CID 138487712) has the molecular formula C17H20ClF3N2O and a molecular weight of 360.81 g/mol. Its IUPAC name is N-[1-[(2R,5S)-5-(3-chlorophenyl)-1-prop-2-enylpyrrolidin-2-yl]-2,2,2-trifluoroethyl]acetamide.
| Compound Name | N-[1-[(2R,5S)-5-(3-chlorophenyl)-1-prop-2-enylpyrrolidin-2-yl]-2,2,2-trifluoroethyl]acetamide |
|---|---|
| PubChem CID | 138487712 |
| Molecular Formula | C17H20ClF3N2O |
| Molecular Weight | 360.81 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-[1-[(2R,5S)-5-(3-chlorophenyl)-1-prop-2-enylpyrrolidin-2-yl]-2,2,2-trifluoroethyl]acetamide |
| SMILES | C=CCN1[C@@H](C(NC(C)=O)C(F)(F)F)CC[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H20ClF3N2O/c1-3-9-23-14(12-5-4-6-13(18)10-12)7-8-15(23)16(17(19,20)21)22-11(2)24/h3-6,10,14-16H,1,7-9H2,2H3,(H,22,24)/t14-,15+,16?/m0/s1 |
| InChIKey | STDQKSAIKPOPQQ-QMRHZFGWSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|