About 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol
3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol (PubChem CID 138488020) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol |
| PubChem CID | 138488020 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol |
| SMILES | CCC(C1=NCCN1)C(C)O |
| InChI | InChI=1S/C8H16N2O/c1-3-7(6(2)11)8-9-4-5-10-8/h6-7,11H,3-5H2,1-2H3,(H,9,10) |
| InChIKey | CRMRSNHBMKFIQZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol?
The IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol (CID 138488020) is 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol.
What is the SMILES notation for 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol?
The canonical SMILES for 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol is CCC(C1=NCCN1)C(C)O.
What is the InChIKey of 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol?
The InChIKey is CRMRSNHBMKFIQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-3-7(6(2)11)8-9-4-5-10-8/h6-7,11H,3-5H2,1-2H3,(H,9,10).
What are the key properties of 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol?
3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol has a molecular weight of 156.23 g/mol, XLogP of 0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1H-imidazol-2-yl)pentan-2-ol is sourced from PubChem (CID 138488020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).