C17H18OS — CID 138488695
2-[(3E)-penta-1,3-dien-3-yl]-2,8,9,10a-tetrahydro-[1]benzothiolo[2,3-b]oxepine (PubChem CID 138488695) has the molecular formula C17H18OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-[(3E)-penta-1,3-dien-3-yl]-2,8,9,10a-tetrahydro-[1]benzothiolo[2,3-b]oxepine.
| Compound Name | 2-[(3E)-penta-1,3-dien-3-yl]-2,8,9,10a-tetrahydro-[1]benzothiolo[2,3-b]oxepine |
|---|---|
| PubChem CID | 138488695 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[(3E)-penta-1,3-dien-3-yl]-2,8,9,10a-tetrahydro-[1]benzothiolo[2,3-b]oxepine |
| SMILES | C=C/C(=C\C)C1C=CC=C2C3=C(CCC=C3)SC2O1 |
| InChI | InChI=1S/C17H18OS/c1-3-12(4-2)15-10-7-9-14-13-8-5-6-11-16(13)19-17(14)18-15/h3-5,7-10,15,17H,1,6,11H2,2H3/b12-4+ |
| InChIKey | PSZBHFIRWZONNX-UUILKARUSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|