C31H42N2O — CID 138489317
(3E,7Z,9Z)-1-(3-ethyl-5-propylpiperidin-1-yl)-4-(4-ethynylphenyl)-9-methyl-2-methyliminoundeca-3,7,9-trien-1-one (PubChem CID 138489317) has the molecular formula C31H42N2O and a molecular weight of 458.69 g/mol. Its IUPAC name is (3E,7Z,9Z)-1-(3-ethyl-5-propylpiperidin-1-yl)-4-(4-ethynylphenyl)-9-methyl-2-methyliminoundeca-3,7,9-trien-1-one.
| Compound Name | (3E,7Z,9Z)-1-(3-ethyl-5-propylpiperidin-1-yl)-4-(4-ethynylphenyl)-9-methyl-2-methyliminoundeca-3,7,9-trien-1-one |
|---|---|
| PubChem CID | 138489317 |
| Molecular Formula | C31H42N2O |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.33 |
| IUPAC Name | (3E,7Z,9Z)-1-(3-ethyl-5-propylpiperidin-1-yl)-4-(4-ethynylphenyl)-9-methyl-2-methyliminoundeca-3,7,9-trien-1-one |
| SMILES | C#Cc1ccc(/C(=C/C(=N\C)C(=O)N2CC(CC)CC(CCC)C2)CC/C=C\C(C)=C/C)cc1 |
| InChI | InChI=1S/C31H42N2O/c1-7-13-27-20-26(10-4)22-33(23-27)31(34)30(32-6)21-29(15-12-11-14-24(5)8-2)28-18-16-25(9-3)17-19-28/h3,8,11,14,16-19,21,26-27H,7,10,12-13,15,20,22-23H2,1-2,4-6H3/b14-11-,24-8-,29-21+,32-30+ |
| InChIKey | RWVJHWRVSKXAKC-RDEWRLSUSA-N |
| XLogP | 7.10 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|