C25H14ClF3N4O2 — CID 138490199
(1E)-2-(1-benzoylindol-3-yl)-N-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethanimidoyl cyanide (PubChem CID 138490199) has the molecular formula C25H14ClF3N4O2 and a molecular weight of 494.86 g/mol. Its IUPAC name is (1E)-2-(1-benzoylindol-3-yl)-N-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-2-(1-benzoylindol-3-yl)-N-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 138490199 |
| Molecular Formula | C25H14ClF3N4O2 |
| Molecular Weight | 494.86 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (1E)-2-(1-benzoylindol-3-yl)-N-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethanimidoyl cyanide |
| SMILES | N#C/C(=N\Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)c1cn(C(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C25H14ClF3N4O2/c26-20-11-10-16(12-19(20)25(27,28)29)31-32-21(13-30)23(34)18-14-33(22-9-5-4-8-17(18)22)24(35)15-6-2-1-3-7-15/h1-12,14,31H/b32-21+ |
| InChIKey | LFZDVULIVAWGMJ-RUMWWMSVSA-N |
| XLogP | 6.18 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.86 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|