C18H16F5NO5S — CID 138490646
N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]benzenesulfonamide (PubChem CID 138490646) has the molecular formula C18H16F5NO5S and a molecular weight of 453.39 g/mol. Its IUPAC name is N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138490646 |
| Molecular Formula | C18H16F5NO5S |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-cyclopropyl-2,3,4,5,6-pentafluoro-N-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1cc(CN(C2CC2)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc(OC)c1O |
| InChI | InChI=1S/C18H16F5NO5S/c1-28-10-5-8(6-11(29-2)17(10)25)7-24(9-3-4-9)30(26,27)18-15(22)13(20)12(19)14(21)16(18)23/h5-6,9,25H,3-4,7H2,1-2H3 |
| InChIKey | ADUSPHOFWJZCMV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|