C27H28FN5O2 — CID 138490946
[(3R)-3-aminopiperidin-1-yl]-[2-[1-(cyclopropylmethyl)-5-fluoroindol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone (PubChem CID 138490946) has the molecular formula C27H28FN5O2 and a molecular weight of 473.55 g/mol. Its IUPAC name is [(3R)-3-aminopiperidin-1-yl]-[2-[1-(cyclopropylmethyl)-5-fluoroindol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone.
| Compound Name | [(3R)-3-aminopiperidin-1-yl]-[2-[1-(cyclopropylmethyl)-5-fluoroindol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
|---|---|
| PubChem CID | 138490946 |
| Molecular Formula | C27H28FN5O2 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | [(3R)-3-aminopiperidin-1-yl]-[2-[1-(cyclopropylmethyl)-5-fluoroindol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
| SMILES | N[C@@H]1CCCN(C(=O)c2cc3c4c(c2)nc(-c2cc5cc(F)ccc5n2CC2CC2)n4CCO3)C1 |
| InChI | InChI=1S/C27H28FN5O2/c28-19-5-6-22-17(10-19)12-23(33(22)14-16-3-4-16)26-30-21-11-18(13-24-25(21)32(26)8-9-35-24)27(34)31-7-1-2-20(29)15-31/h5-6,10-13,16,20H,1-4,7-9,14-15,29H2/t20-/m1/s1 |
| InChIKey | LDFXPUUHGIRAJW-HXUWFJFHSA-N |
| XLogP | 4.16 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |