C19H22N6O3 — CID 138491189
N,N-dimethyl-2-[(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)methoxy]ethanamine;formic acid (PubChem CID 138491189) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)methoxy]ethanamine;formic acid.
| Compound Name | N,N-dimethyl-2-[(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)methoxy]ethanamine;formic acid |
|---|---|
| PubChem CID | 138491189 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N,N-dimethyl-2-[(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)methoxy]ethanamine;formic acid |
| SMILES | CN(C)CCOCc1cc2c(-c3cnn4ncccc34)ccnc2[nH]1.O=CO |
| InChI | InChI=1S/C18H20N6O.CH2O2/c1-23(2)8-9-25-12-13-10-15-14(5-7-19-18(15)22-13)16-11-21-24-17(16)4-3-6-20-24;2-1-3/h3-7,10-11H,8-9,12H2,1-2H3,(H,19,22);1H,(H,2,3) |
| InChIKey | GAAKCMHYCUYZOQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|