About 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline
3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline (PubChem CID 138491240) has the molecular formula C19H14N6
and a molecular weight of 326.36 g/mol. Its IUPAC name is 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline.
Molecular Properties
| Compound Name | 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline |
| PubChem CID | 138491240 |
| Molecular Formula | C19H14N6 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline |
| SMILES | Nc1cccc(-c2cc3c(-c4cnn5ncccc45)ccnc3[nH]2)c1 |
| InChI | InChI=1S/C19H14N6/c20-13-4-1-3-12(9-13)17-10-15-14(6-8-21-19(15)24-17)16-11-23-25-18(16)5-2-7-22-25/h1-11H,20H2,(H,21,24) |
| InChIKey | IHSKPBBTUBDQAG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline?
The IUPAC name of 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline (CID 138491240) is 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline.
What is the SMILES notation for 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline?
The canonical SMILES for 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline is Nc1cccc(-c2cc3c(-c4cnn5ncccc45)ccnc3[nH]2)c1.
What is the InChIKey of 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline?
The InChIKey is IHSKPBBTUBDQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N6/c20-13-4-1-3-12(9-13)17-10-15-14(6-8-21-19(15)24-17)16-11-23-25-18(16)5-2-7-22-25/h1-11H,20H2,(H,21,24).
What are the key properties of 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline?
3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline has a molecular weight of 326.36 g/mol, XLogP of 3.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-pyrazolo[1,5-b]pyridazin-3-yl-1H-pyrrolo[2,3-b]pyridin-2-yl)aniline is sourced from PubChem (CID 138491240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).