C9H13NO3 — CID 138491258
trans-(1R,3R)-3-(prop-2-enoylamino)cyclopentane-1-carboxylic acid (PubChem CID 138491258) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is trans-(1R,3R)-3-(prop-2-enoylamino)cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,3R)-3-(prop-2-enoylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 138491258 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | trans-(1R,3R)-3-(prop-2-enoylamino)cyclopentane-1-carboxylic acid |
| SMILES | C=CC(=O)N[C@@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C9H13NO3/c1-2-8(11)10-7-4-3-6(5-7)9(12)13/h2,6-7H,1,3-5H2,(H,10,11)(H,12,13)/t6-,7-/m1/s1 |
| InChIKey | QWIHKKIRJMLCGT-RNFRBKRXSA-N |
| XLogP | 0.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|