About N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide
N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide (PubChem CID 138491575) has the molecular formula C16H14FN3O2
and a molecular weight of 299.31 g/mol. Its IUPAC name is N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide |
| PubChem CID | 138491575 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide |
| SMILES | Cc1cc(C#N)cc(C)c1CNC(=O)c1ncc(F)cc1O |
| InChI | InChI=1S/C16H14FN3O2/c1-9-3-11(6-18)4-10(2)13(9)8-20-16(22)15-14(21)5-12(17)7-19-15/h3-5,7,21H,8H2,1-2H3,(H,20,22) |
| InChIKey | CJDTYUIHBBXLDS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide?
The IUPAC name of N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide (CID 138491575) is N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide.
What is the SMILES notation for N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide?
The canonical SMILES for N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide is Cc1cc(C#N)cc(C)c1CNC(=O)c1ncc(F)cc1O.
What is the InChIKey of N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide?
The InChIKey is CJDTYUIHBBXLDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FN3O2/c1-9-3-11(6-18)4-10(2)13(9)8-20-16(22)15-14(21)5-12(17)7-19-15/h3-5,7,21H,8H2,1-2H3,(H,20,22).
What are the key properties of N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide?
N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide has a molecular weight of 299.31 g/mol, XLogP of 2.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-cyano-2,6-dimethylphenyl)methyl]-5-fluoro-3-hydroxypyridine-2-carboxamide is sourced from PubChem (CID 138491575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).