C25H39NO3 — CID 138491578
(4Z,7Z)-N-(1-hydroxypropan-2-yl)-9-[3-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]oxiran-2-yl]nona-4,7-dienamide (PubChem CID 138491578) has the molecular formula C25H39NO3 and a molecular weight of 401.59 g/mol. Its IUPAC name is (4Z,7Z)-N-(1-hydroxypropan-2-yl)-9-[3-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]oxiran-2-yl]nona-4,7-dienamide.
| Compound Name | (4Z,7Z)-N-(1-hydroxypropan-2-yl)-9-[3-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]oxiran-2-yl]nona-4,7-dienamide |
|---|---|
| PubChem CID | 138491578 |
| Molecular Formula | C25H39NO3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | (4Z,7Z)-N-(1-hydroxypropan-2-yl)-9-[3-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]oxiran-2-yl]nona-4,7-dienamide |
| SMILES | CC/C=C\C/C=C\C/C=C\CC1OC1C/C=C\C/C=C\CCC(=O)NC(C)CO |
| InChI | InChI=1S/C25H39NO3/c1-3-4-5-6-7-8-9-12-15-18-23-24(29-23)19-16-13-10-11-14-17-20-25(28)26-22(2)21-27/h4-5,7-8,11-16,22-24,27H,3,6,9-10,17-21H2,1-2H3,(H,26,28)/b5-4-,8-7-,14-11-,15-12-,16-13- |
| InChIKey | QWHBASULGNSUSE-ZLOWPGFWSA-N |
| XLogP | 5.17 |
| TPSA | 61.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|