C13H19NO5S — CID 138492097
[(2R,3R)-2-amino-3-(4-cyclopropyloxyphenyl)-3-hydroxypropyl] methanesulfonate (PubChem CID 138492097) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is [(2R,3R)-2-amino-3-(4-cyclopropyloxyphenyl)-3-hydroxypropyl] methanesulfonate.
| Compound Name | [(2R,3R)-2-amino-3-(4-cyclopropyloxyphenyl)-3-hydroxypropyl] methanesulfonate |
|---|---|
| PubChem CID | 138492097 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [(2R,3R)-2-amino-3-(4-cyclopropyloxyphenyl)-3-hydroxypropyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H](N)[C@H](O)c1ccc(OC2CC2)cc1 |
| InChI | InChI=1S/C13H19NO5S/c1-20(16,17)18-8-12(14)13(15)9-2-4-10(5-3-9)19-11-6-7-11/h2-5,11-13,15H,6-8,14H2,1H3/t12-,13-/m1/s1 |
| InChIKey | MIRZXIVEOJTHLM-CHWSQXEVSA-N |
| XLogP | 0.56 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|