C22H29N5O3S — CID 138492329
2-amino-4-[(dipropylamino)-hydroxymethyl]-N-pyridin-3-yl-3H-1-benzazepine-8-sulfonamide (PubChem CID 138492329) has the molecular formula C22H29N5O3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-amino-4-[(dipropylamino)-hydroxymethyl]-N-pyridin-3-yl-3H-1-benzazepine-8-sulfonamide.
| Compound Name | 2-amino-4-[(dipropylamino)-hydroxymethyl]-N-pyridin-3-yl-3H-1-benzazepine-8-sulfonamide |
|---|---|
| PubChem CID | 138492329 |
| Molecular Formula | C22H29N5O3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 2-amino-4-[(dipropylamino)-hydroxymethyl]-N-pyridin-3-yl-3H-1-benzazepine-8-sulfonamide |
| SMILES | CCCN(CCC)C(O)C1=Cc2ccc(S(=O)(=O)Nc3cccnc3)cc2N=C(N)C1 |
| InChI | InChI=1S/C22H29N5O3S/c1-3-10-27(11-4-2)22(28)17-12-16-7-8-19(14-20(16)25-21(23)13-17)31(29,30)26-18-6-5-9-24-15-18/h5-9,12,14-15,22,26,28H,3-4,10-11,13H2,1-2H3,(H2,23,25) |
| InChIKey | CAIVFMUWRTXMQW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|