C25H33FN7O6PS — CID 138492457
ethyl (2S)-2-[[[(1R,3R,4R,5S)-3-[2-amino-6-(dimethylamino)purin-9-yl]-4-fluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-(phenylsulfanylmethyl)phosphoryl]amino]propanoate (PubChem CID 138492457) has the molecular formula C25H33FN7O6PS and a molecular weight of 609.62 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(1R,3R,4R,5S)-3-[2-amino-6-(dimethylamino)purin-9-yl]-4-fluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-(phenylsulfanylmethyl)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(1R,3R,4R,5S)-3-[2-amino-6-(dimethylamino)purin-9-yl]-4-fluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-(phenylsulfanylmethyl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 138492457 |
| Molecular Formula | C25H33FN7O6PS |
| Molecular Weight | 609.62 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | ethyl (2S)-2-[[[(1R,3R,4R,5S)-3-[2-amino-6-(dimethylamino)purin-9-yl]-4-fluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-(phenylsulfanylmethyl)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(CSc1ccccc1)OC1[C@H]2O[C@@H](n3cnc4c(N(C)C)nc(N)nc43)[C@](C)(F)[C@@]12O |
| InChI | InChI=1S/C25H33FN7O6PS/c1-6-37-21(34)14(2)31-40(36,13-41-15-10-8-7-9-11-15)39-18-17-25(18,35)24(3,26)22(38-17)33-12-28-16-19(32(4)5)29-23(27)30-20(16)33/h7-12,14,17-18,22,35H,6,13H2,1-5H3,(H,31,36)(H2,27,29,30)/t14-,17+,18?,22+,24-,25-,40?/m0/s1 |
| InChIKey | INVDHFIOGUGPBT-GUPLPSJFSA-N |
| XLogP | 2.71 |
| TPSA | 166.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|