C21H26N2O4 — CID 138492553
(3S)-3-cyclohexa-2,4-dien-1-yl-4-(2,2-dimethylpropanoyl)-N-hydroxy-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide (PubChem CID 138492553) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (3S)-3-cyclohexa-2,4-dien-1-yl-4-(2,2-dimethylpropanoyl)-N-hydroxy-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide.
| Compound Name | (3S)-3-cyclohexa-2,4-dien-1-yl-4-(2,2-dimethylpropanoyl)-N-hydroxy-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 138492553 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (3S)-3-cyclohexa-2,4-dien-1-yl-4-(2,2-dimethylpropanoyl)-N-hydroxy-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
| SMILES | CC(C)(C)C(=O)N1Cc2ccc(C(=O)NO)cc2OC[C@@H]1C1C=CC=CC1 |
| InChI | InChI=1S/C21H26N2O4/c1-21(2,3)20(25)23-12-16-10-9-15(19(24)22-26)11-18(16)27-13-17(23)14-7-5-4-6-8-14/h4-7,9-11,14,17,26H,8,12-13H2,1-3H3,(H,22,24)/t14?,17-/m1/s1 |
| InChIKey | UHDGNLFNDRPLCG-FBMWCMRBSA-N |
| XLogP | 3.07 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|