About 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one
4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one (PubChem CID 138492627) has the molecular formula C12H19ClN4O
and a molecular weight of 270.76 g/mol. Its IUPAC name is 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one |
| PubChem CID | 138492627 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one |
| SMILES | C[C@@H]1CC(Nc2cnn(C)c(=O)c2Cl)CN(C)C1 |
| InChI | InChI=1S/C12H19ClN4O/c1-8-4-9(7-16(2)6-8)15-10-5-14-17(3)12(18)11(10)13/h5,8-9,15H,4,6-7H2,1-3H3/t8-,9?/m1/s1 |
| InChIKey | MRZBXPNVEWAIIA-VEDVMXKPSA-N |
| XLogP | 1.19 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one?
The IUPAC name of 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one (CID 138492627) is 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one.
What is the SMILES notation for 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one?
The canonical SMILES for 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one is C[C@@H]1CC(Nc2cnn(C)c(=O)c2Cl)CN(C)C1.
What is the InChIKey of 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one?
The InChIKey is MRZBXPNVEWAIIA-VEDVMXKPSA-N. The full InChI is InChI=1S/C12H19ClN4O/c1-8-4-9(7-16(2)6-8)15-10-5-14-17(3)12(18)11(10)13/h5,8-9,15H,4,6-7H2,1-3H3/t8-,9?/m1/s1.
What are the key properties of 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one?
4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one has a molecular weight of 270.76 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-[[(5R)-1,5-dimethylpiperidin-3-yl]amino]-2-methylpyridazin-3-one is sourced from PubChem (CID 138492627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).