C23H41NO — CID 138492860
(3R,4aR)-3-ethenyl-3,4a,5,6,7,7,10a,10b-octamethyl-1,2,5,6,6a,8,9,10-octahydrobenzo[f]chromen-1-amine (PubChem CID 138492860) has the molecular formula C23H41NO and a molecular weight of 347.59 g/mol. Its IUPAC name is (3R,4aR)-3-ethenyl-3,4a,5,6,7,7,10a,10b-octamethyl-1,2,5,6,6a,8,9,10-octahydrobenzo[f]chromen-1-amine.
| Compound Name | (3R,4aR)-3-ethenyl-3,4a,5,6,7,7,10a,10b-octamethyl-1,2,5,6,6a,8,9,10-octahydrobenzo[f]chromen-1-amine |
|---|---|
| PubChem CID | 138492860 |
| Molecular Formula | C23H41NO |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 347.32 |
| IUPAC Name | (3R,4aR)-3-ethenyl-3,4a,5,6,7,7,10a,10b-octamethyl-1,2,5,6,6a,8,9,10-octahydrobenzo[f]chromen-1-amine |
| SMILES | C=C[C@@]1(C)CC(N)C2(C)C3(C)CCCC(C)(C)C3C(C)C(C)[C@@]2(C)O1 |
| InChI | InChI=1S/C23H41NO/c1-10-20(6)14-17(24)22(8)21(7)13-11-12-19(4,5)18(21)15(2)16(3)23(22,9)25-20/h10,15-18H,1,11-14,24H2,2-9H3/t15?,16?,17?,18?,20-,21?,22?,23+/m0/s1 |
| InChIKey | OZZHBKDVNKLWDM-HOLXPGRTSA-N |
| XLogP | 5.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|