C36H44N2O5 — CID 138492986
tert-butyl (3aR)-2-[2-[4-[(Z)-5-hydroxy-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenoxy]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 138492986) has the molecular formula C36H44N2O5 and a molecular weight of 584.76 g/mol. Its IUPAC name is tert-butyl (3aR)-2-[2-[4-[(Z)-5-hydroxy-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenoxy]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR)-2-[2-[4-[(Z)-5-hydroxy-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenoxy]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 138492986 |
| Molecular Formula | C36H44N2O5 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | tert-butyl (3aR)-2-[2-[4-[(Z)-5-hydroxy-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenoxy]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(CCOc3ccc(/C(=C(/CCCO)c4ccccc4)c4ccc(O)cc4)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C36H44N2O5/c1-36(2,3)43-35(41)38-24-29-22-37(23-30(29)25-38)19-21-42-32-17-13-28(14-18-32)34(27-11-15-31(40)16-12-27)33(10-7-20-39)26-8-5-4-6-9-26/h4-6,8-9,11-18,29-30,39-40H,7,10,19-25H2,1-3H3/b34-33-/t29-,30?/m1/s1 |
| InChIKey | AOQHDUJPVUWFKQ-QLVHIMNUSA-N |
| XLogP | 6.30 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|