C31H37N3O3 — CID 138493154
4-[(Z)-1-[4-[2-[(3aS,6aS)-3a-amino-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethoxy]phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol (PubChem CID 138493154) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 4-[(Z)-1-[4-[2-[(3aS,6aS)-3a-amino-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethoxy]phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol.
| Compound Name | 4-[(Z)-1-[4-[2-[(3aS,6aS)-3a-amino-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethoxy]phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol |
|---|---|
| PubChem CID | 138493154 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 4-[(Z)-1-[4-[2-[(3aS,6aS)-3a-amino-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethoxy]phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol |
| SMILES | N[C@]12CNC[C@H]1CN(CCOc1ccc(/C(=C(/CCCO)c3ccccc3)c3ccc(O)cc3)cc1)C2 |
| InChI | InChI=1S/C31H37N3O3/c32-31-21-33-19-26(31)20-34(22-31)16-18-37-28-14-10-25(11-15-28)30(24-8-12-27(36)13-9-24)29(7-4-17-35)23-5-2-1-3-6-23/h1-3,5-6,8-15,26,33,35-36H,4,7,16-22,32H2/b30-29-/t26-,31-/m0/s1 |
| InChIKey | DNZXKFZPIVOGQD-FBRXESBVSA-N |
| XLogP | 3.74 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|