C33H44N2O3 — CID 138493190
4-[(1Z,3E,5Z)-2-(3-hydroxypropyl)-3-methyl-1-[4-[2-[2-(3-methylpyrrolidin-3-yl)ethylamino]ethoxy]phenyl]octa-1,3,5,7-tetraenyl]phenol (PubChem CID 138493190) has the molecular formula C33H44N2O3 and a molecular weight of 516.73 g/mol. Its IUPAC name is 4-[(1Z,3E,5Z)-2-(3-hydroxypropyl)-3-methyl-1-[4-[2-[2-(3-methylpyrrolidin-3-yl)ethylamino]ethoxy]phenyl]octa-1,3,5,7-tetraenyl]phenol.
| Compound Name | 4-[(1Z,3E,5Z)-2-(3-hydroxypropyl)-3-methyl-1-[4-[2-[2-(3-methylpyrrolidin-3-yl)ethylamino]ethoxy]phenyl]octa-1,3,5,7-tetraenyl]phenol |
|---|---|
| PubChem CID | 138493190 |
| Molecular Formula | C33H44N2O3 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | 4-[(1Z,3E,5Z)-2-(3-hydroxypropyl)-3-methyl-1-[4-[2-[2-(3-methylpyrrolidin-3-yl)ethylamino]ethoxy]phenyl]octa-1,3,5,7-tetraenyl]phenol |
| SMILES | C=C/C=C\C=C(C)\C(CCCO)=C(\c1ccc(O)cc1)c1ccc(OCCNCCC2(C)CCNC2)cc1 |
| InChI | InChI=1S/C33H44N2O3/c1-4-5-6-8-26(2)31(9-7-23-36)32(27-10-14-29(37)15-11-27)28-12-16-30(17-13-28)38-24-22-34-20-18-33(3)19-21-35-25-33/h4-6,8,10-17,34-37H,1,7,9,18-25H2,2-3H3/b6-5-,26-8+,32-31- |
| InChIKey | RMVWELXBEBHDKP-UPSGHDRZSA-N |
| XLogP | 6.01 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|