C31H37IN2O3 — CID 138493219
4-[(Z)-5-hydroxy-1-[4-[2-[iodo-[[(3S,4R)-4-methylpyrrolidin-3-yl]methyl]amino]ethoxy]phenyl]-2-phenylpent-1-enyl]phenol (PubChem CID 138493219) has the molecular formula C31H37IN2O3 and a molecular weight of 612.55 g/mol. Its IUPAC name is 4-[(Z)-5-hydroxy-1-[4-[2-[iodo-[[(3S,4R)-4-methylpyrrolidin-3-yl]methyl]amino]ethoxy]phenyl]-2-phenylpent-1-enyl]phenol.
| Compound Name | 4-[(Z)-5-hydroxy-1-[4-[2-[iodo-[[(3S,4R)-4-methylpyrrolidin-3-yl]methyl]amino]ethoxy]phenyl]-2-phenylpent-1-enyl]phenol |
|---|---|
| PubChem CID | 138493219 |
| Molecular Formula | C31H37IN2O3 |
| Molecular Weight | 612.55 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | 4-[(Z)-5-hydroxy-1-[4-[2-[iodo-[[(3S,4R)-4-methylpyrrolidin-3-yl]methyl]amino]ethoxy]phenyl]-2-phenylpent-1-enyl]phenol |
| SMILES | C[C@H]1CNC[C@H]1CN(I)CCOc1ccc(/C(=C(/CCCO)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C31H37IN2O3/c1-23-20-33-21-27(23)22-34(32)17-19-37-29-15-11-26(12-16-29)31(25-9-13-28(36)14-10-25)30(8-5-18-35)24-6-3-2-4-7-24/h2-4,6-7,9-16,23,27,33,35-36H,5,8,17-22H2,1H3/b31-30-/t23-,27-/m0/s1 |
| InChIKey | CFCPWNDRNHOKIT-ZGTSQRLSSA-N |
| XLogP | 6.01 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|