About 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine
10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine (PubChem CID 138493763) has the molecular formula C18H18Cl2N2S
and a molecular weight of 365.33 g/mol. Its IUPAC name is 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine.
Molecular Properties
| Compound Name | 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine |
| PubChem CID | 138493763 |
| Molecular Formula | C18H18Cl2N2S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine |
| SMILES | Clc1ccc2c(c1)Sc1cc(Cl)ccc1N2[C@@H]1CCCNCC1 |
| InChI | InChI=1S/C18H18Cl2N2S/c19-12-3-5-15-17(10-12)23-18-11-13(20)4-6-16(18)22(15)14-2-1-8-21-9-7-14/h3-6,10-11,14,21H,1-2,7-9H2/t14-/m1/s1 |
| InChIKey | YLCGHCHNEKSTCG-CQSZACIVSA-N |
| XLogP | 5.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine?
The IUPAC name of 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine (CID 138493763) is 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine.
What is the SMILES notation for 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine?
The canonical SMILES for 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine is Clc1ccc2c(c1)Sc1cc(Cl)ccc1N2[C@@H]1CCCNCC1.
What is the InChIKey of 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine?
The InChIKey is YLCGHCHNEKSTCG-CQSZACIVSA-N. The full InChI is InChI=1S/C18H18Cl2N2S/c19-12-3-5-15-17(10-12)23-18-11-13(20)4-6-16(18)22(15)14-2-1-8-21-9-7-14/h3-6,10-11,14,21H,1-2,7-9H2/t14-/m1/s1.
What are the key properties of 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine?
10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine has a molecular weight of 365.33 g/mol, XLogP of 5.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[(4R)-azepan-4-yl]-3,7-dichlorophenothiazine is sourced from PubChem (CID 138493763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).