C14H22FNO — CID 138494336
2-[(2R,5S)-5-[(2E,4Z)-6-fluorohepta-2,4,6-trien-2-yl]pyrrolidin-2-yl]propan-2-ol (PubChem CID 138494336) has the molecular formula C14H22FNO and a molecular weight of 239.33 g/mol. Its IUPAC name is 2-[(2R,5S)-5-[(2E,4Z)-6-fluorohepta-2,4,6-trien-2-yl]pyrrolidin-2-yl]propan-2-ol.
| Compound Name | 2-[(2R,5S)-5-[(2E,4Z)-6-fluorohepta-2,4,6-trien-2-yl]pyrrolidin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 138494336 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 2-[(2R,5S)-5-[(2E,4Z)-6-fluorohepta-2,4,6-trien-2-yl]pyrrolidin-2-yl]propan-2-ol |
| SMILES | C=C(F)/C=C\C=C(/C)[C@@H]1CC[C@H](C(C)(C)O)N1 |
| InChI | InChI=1S/C14H22FNO/c1-10(6-5-7-11(2)15)12-8-9-13(16-12)14(3,4)17/h5-7,12-13,16-17H,2,8-9H2,1,3-4H3/b7-5-,10-6+/t12-,13+/m0/s1 |
| InChIKey | PPNYWMGVORIHAJ-PSZDNWLRSA-N |
| XLogP | 2.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|