About 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine
2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine (PubChem CID 138494351) has the molecular formula C10H13F2N
and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine |
| PubChem CID | 138494351 |
| Molecular Formula | C10H13F2N |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine |
| SMILES | FC1=CC(C2CCC(F)N2)=CCC1 |
| InChI | InChI=1S/C10H13F2N/c11-8-3-1-2-7(6-8)9-4-5-10(12)13-9/h2,6,9-10,13H,1,3-5H2 |
| InChIKey | WMAODMXOFOIBLS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine?
The IUPAC name of 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine (CID 138494351) is 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine.
What is the SMILES notation for 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine?
The canonical SMILES for 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine is FC1=CC(C2CCC(F)N2)=CCC1.
What is the InChIKey of 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine?
The InChIKey is WMAODMXOFOIBLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2N/c11-8-3-1-2-7(6-8)9-4-5-10(12)13-9/h2,6,9-10,13H,1,3-5H2.
What are the key properties of 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine?
2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine has a molecular weight of 185.22 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-(5-fluorocyclohexa-1,5-dien-1-yl)pyrrolidine is sourced from PubChem (CID 138494351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).