C29H35FN4O3 — CID 138494355
4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[(2S,5R)-2-(3-fluorophenyl)-5-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide (PubChem CID 138494355) has the molecular formula C29H35FN4O3 and a molecular weight of 506.62 g/mol. Its IUPAC name is 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[(2S,5R)-2-(3-fluorophenyl)-5-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide.
| Compound Name | 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[(2S,5R)-2-(3-fluorophenyl)-5-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 138494355 |
| Molecular Formula | C29H35FN4O3 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[(2S,5R)-2-(3-fluorophenyl)-5-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide |
| SMILES | [H]/N=C(C)/C=C(/Cc1ccc(C(=O)NCC(=O)N2[C@@H](C(C)C)CC[C@H]2c2cccc(F)c2)cc1C)C(N)=O |
| InChI | InChI=1S/C29H35FN4O3/c1-17(2)25-10-11-26(21-6-5-7-24(30)15-21)34(25)27(35)16-33-29(37)22-9-8-20(18(3)12-22)14-23(28(32)36)13-19(4)31/h5-9,12-13,15,17,25-26,31H,10-11,14,16H2,1-4H3,(H2,32,36)(H,33,37)/b23-13-,31-19+/t25-,26+/m1/s1 |
| InChIKey | JTNKFUCDBSKCEC-TXYZDXNISA-N |
| XLogP | 4.25 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|