C16H22ClFN2 — CID 138494369
2-[5-[(1E,3E,5E)-1-chloro-6-fluoroocta-1,3,5-trien-3-yl]pyrrolidin-2-yl]-2-methylpropanenitrile (PubChem CID 138494369) has the molecular formula C16H22ClFN2 and a molecular weight of 296.82 g/mol. Its IUPAC name is 2-[5-[(1E,3E,5E)-1-chloro-6-fluoroocta-1,3,5-trien-3-yl]pyrrolidin-2-yl]-2-methylpropanenitrile.
| Compound Name | 2-[5-[(1E,3E,5E)-1-chloro-6-fluoroocta-1,3,5-trien-3-yl]pyrrolidin-2-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 138494369 |
| Molecular Formula | C16H22ClFN2 |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-[5-[(1E,3E,5E)-1-chloro-6-fluoroocta-1,3,5-trien-3-yl]pyrrolidin-2-yl]-2-methylpropanenitrile |
| SMILES | CC/C(F)=C\C=C(/C=C/Cl)C1CCC(C(C)(C)C#N)N1 |
| InChI | InChI=1S/C16H22ClFN2/c1-4-13(18)6-5-12(9-10-17)14-7-8-15(20-14)16(2,3)11-19/h5-6,9-10,14-15,20H,4,7-8H2,1-3H3/b10-9+,12-5+,13-6+ |
| InChIKey | SQWXYCHENXFKLR-QBCZLABZSA-N |
| XLogP | 4.60 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|