C20H35NS — CID 138494506
N-ethenyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-amine (PubChem CID 138494506) has the molecular formula C20H35NS and a molecular weight of 321.57 g/mol. Its IUPAC name is N-ethenyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-amine.
| Compound Name | N-ethenyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 138494506 |
| Molecular Formula | C20H35NS |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | N-ethenyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-amine |
| SMILES | C=CNC(C)CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H35NS/c1-7-21-20(6)16-22-15-14-19(5)13-9-12-18(4)11-8-10-17(2)3/h7,10,12,14,20-21H,1,8-9,11,13,15-16H2,2-6H3/b18-12+,19-14+ |
| InChIKey | HSWGXDZEMROEFF-IJNKXORISA-N |
| XLogP | 6.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|