C29H27BrN2O2 — CID 138494530
1,8-dimethoxy-N,N-dimethyl-9,10-diphenylacridin-10-ium-3-amine bromide (PubChem CID 138494530) has the molecular formula C29H27BrN2O2 and a molecular weight of 515.45 g/mol. Its IUPAC name is 1,8-dimethoxy-N,N-dimethyl-9,10-diphenylacridin-10-ium-3-amine bromide.
| Compound Name | 1,8-dimethoxy-N,N-dimethyl-9,10-diphenylacridin-10-ium-3-amine bromide |
|---|---|
| PubChem CID | 138494530 |
| Molecular Formula | C29H27BrN2O2 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 1,8-dimethoxy-N,N-dimethyl-9,10-diphenylacridin-10-ium-3-amine bromide |
| SMILES | COc1cccc2c1c(-c1ccccc1)c1c(OC)cc(N(C)C)cc1[n+]2-c1ccccc1.[Br-] |
| InChI | InChI=1S/C29H27N2O2.BrH/c1-30(2)22-18-24-29(26(19-22)33-4)27(20-12-7-5-8-13-20)28-23(16-11-17-25(28)32-3)31(24)21-14-9-6-10-15-21;/h5-19H,1-4H3;1H/q+1;/p-1 |
| InChIKey | AOPJYPIPAFNILT-UHFFFAOYSA-M |
| XLogP | 3.02 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|