C31H31N2O+ — CID 138494534
8-methoxy-N,N-dimethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-3-amine (PubChem CID 138494534) has the molecular formula C31H31N2O+ and a molecular weight of 447.60 g/mol. Its IUPAC name is 8-methoxy-N,N-dimethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-3-amine.
| Compound Name | 8-methoxy-N,N-dimethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-3-amine |
|---|---|
| PubChem CID | 138494534 |
| Molecular Formula | C31H31N2O+ |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 8-methoxy-N,N-dimethyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium-3-amine |
| SMILES | COc1cccc2c1c(-c1c(C)cc(C)cc1C)c1ccc(N(C)C)cc1[n+]2-c1ccccc1 |
| InChI | InChI=1S/C31H31N2O/c1-20-17-21(2)29(22(3)18-20)30-25-16-15-24(32(4)5)19-27(25)33(23-11-8-7-9-12-23)26-13-10-14-28(34-6)31(26)30/h7-19H,1-6H3/q+1 |
| InChIKey | SLKBEUZLTNTRHR-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|