About 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide
6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide (PubChem CID 138494834) has the molecular formula C16H19ClN4O2
and a molecular weight of 334.81 g/mol. Its IUPAC name is 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide |
| PubChem CID | 138494834 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide |
| SMILES | CC1(C)COCCC1Nc1c(C(N)=O)nnc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H19ClN4O2/c1-16(2)8-23-6-5-12(16)19-13-10-7-9(17)3-4-11(10)20-21-14(13)15(18)22/h3-4,7,12H,5-6,8H2,1-2H3,(H2,18,22)(H,19,20) |
| InChIKey | AQBUOFNFWRQBIW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide?
The IUPAC name of 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide (CID 138494834) is 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide.
What is the SMILES notation for 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide?
The canonical SMILES for 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide is CC1(C)COCCC1Nc1c(C(N)=O)nnc2ccc(Cl)cc12.
What is the InChIKey of 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide?
The InChIKey is AQBUOFNFWRQBIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN4O2/c1-16(2)8-23-6-5-12(16)19-13-10-7-9(17)3-4-11(10)20-21-14(13)15(18)22/h3-4,7,12H,5-6,8H2,1-2H3,(H2,18,22)(H,19,20).
What are the key properties of 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide?
6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide has a molecular weight of 334.81 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-[(3,3-dimethyloxan-4-yl)amino]cinnoline-3-carboxamide is sourced from PubChem (CID 138494834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).