C16H28N2 — CID 138495102
(3R)-2-N-(cyclohexa-1,5-dien-1-ylmethyl)-2-N-ethyl-5-methylhex-4-ene-2,3-diamine (PubChem CID 138495102) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (3R)-2-N-(cyclohexa-1,5-dien-1-ylmethyl)-2-N-ethyl-5-methylhex-4-ene-2,3-diamine.
| Compound Name | (3R)-2-N-(cyclohexa-1,5-dien-1-ylmethyl)-2-N-ethyl-5-methylhex-4-ene-2,3-diamine |
|---|---|
| PubChem CID | 138495102 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (3R)-2-N-(cyclohexa-1,5-dien-1-ylmethyl)-2-N-ethyl-5-methylhex-4-ene-2,3-diamine |
| SMILES | CCN(CC1=CCCC=C1)C(C)[C@H](N)C=C(C)C |
| InChI | InChI=1S/C16H28N2/c1-5-18(12-15-9-7-6-8-10-15)14(4)16(17)11-13(2)3/h7,9-11,14,16H,5-6,8,12,17H2,1-4H3/t14?,16-/m1/s1 |
| InChIKey | BAYHWYNFCHGWBZ-BZSJEYESSA-N |
| XLogP | 3.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|