C17H34N2 — CID 138495177
(2Z)-1,4,6,6,8-pentamethyl-7-propan-2-ylcyclonon-2-ene-1,4-diamine (PubChem CID 138495177) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is (2Z)-1,4,6,6,8-pentamethyl-7-propan-2-ylcyclonon-2-ene-1,4-diamine.
| Compound Name | (2Z)-1,4,6,6,8-pentamethyl-7-propan-2-ylcyclonon-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 138495177 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | (2Z)-1,4,6,6,8-pentamethyl-7-propan-2-ylcyclonon-2-ene-1,4-diamine |
| SMILES | CC(C)C1C(C)CC(C)(N)/C=C\C(C)(N)CC1(C)C |
| InChI | InChI=1S/C17H34N2/c1-12(2)14-13(3)10-16(6,18)8-9-17(7,19)11-15(14,4)5/h8-9,12-14H,10-11,18-19H2,1-7H3/b9-8- |
| InChIKey | KZIFJVDCSVLURE-HJWRWDBZSA-N |
| XLogP | 3.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|