C18H25N7O — CID 138495221
2-[(1-tert-butylpyrazol-4-yl)amino]-4-[[(2E,4E)-hexa-2,4-dienyl]amino]pyrimidine-5-carboxamide (PubChem CID 138495221) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is 2-[(1-tert-butylpyrazol-4-yl)amino]-4-[[(2E,4E)-hexa-2,4-dienyl]amino]pyrimidine-5-carboxamide.
| Compound Name | 2-[(1-tert-butylpyrazol-4-yl)amino]-4-[[(2E,4E)-hexa-2,4-dienyl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 138495221 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2-[(1-tert-butylpyrazol-4-yl)amino]-4-[[(2E,4E)-hexa-2,4-dienyl]amino]pyrimidine-5-carboxamide |
| SMILES | C/C=C/C=C/CNc1nc(Nc2cnn(C(C)(C)C)c2)ncc1C(N)=O |
| InChI | InChI=1S/C18H25N7O/c1-5-6-7-8-9-20-16-14(15(19)26)11-21-17(24-16)23-13-10-22-25(12-13)18(2,3)4/h5-8,10-12H,9H2,1-4H3,(H2,19,26)(H2,20,21,23,24)/b6-5+,8-7+ |
| InChIKey | WHFXXLVTYFBXRW-BSWSSELBSA-N |
| XLogP | 2.81 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|