About [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium
[4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium (PubChem CID 138495288) has the molecular formula C18H32N+
and a molecular weight of 262.46 g/mol. Its IUPAC name is [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium.
Molecular Properties
| Compound Name | [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium |
| PubChem CID | 138495288 |
| Molecular Formula | C18H32N+ |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium |
| SMILES | CC(C)CC(c1ccc(C[N+](C)(C)C)cc1)C(C)C |
| InChI | InChI=1S/C18H32N/c1-14(2)12-18(15(3)4)17-10-8-16(9-11-17)13-19(5,6)7/h8-11,14-15,18H,12-13H2,1-7H3/q+1 |
| InChIKey | DDXAPSXOTVXEED-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium?
The IUPAC name of [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium (CID 138495288) is [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium.
What is the SMILES notation for [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium?
The canonical SMILES for [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium is CC(C)CC(c1ccc(C[N+](C)(C)C)cc1)C(C)C.
What is the InChIKey of [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium?
The InChIKey is DDXAPSXOTVXEED-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N/c1-14(2)12-18(15(3)4)17-10-8-16(9-11-17)13-19(5,6)7/h8-11,14-15,18H,12-13H2,1-7H3/q+1.
What are the key properties of [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium?
[4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium has a molecular weight of 262.46 g/mol, XLogP of 4.68, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,5-dimethylhexan-3-yl)phenyl]methyl-trimethylazanium is sourced from PubChem (CID 138495288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).