C23H23F7O6 — CID 138495514
(2R,3R,4S,5R,6S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-[(4-fluorophenyl)methoxy]-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 138495514) has the molecular formula C23H23F7O6 and a molecular weight of 528.42 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-[(4-fluorophenyl)methoxy]-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-[(4-fluorophenyl)methoxy]-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 138495514 |
| Molecular Formula | C23H23F7O6 |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | (2R,3R,4S,5R,6S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-[(4-fluorophenyl)methoxy]-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | C[C@@H](O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1OCc1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H23F7O6/c1-11(13-6-14(22(25,26)27)8-15(7-13)23(28,29)30)35-21-20(19(33)18(32)17(9-31)36-21)34-10-12-2-4-16(24)5-3-12/h2-8,11,17-21,31-33H,9-10H2,1H3/t11-,17-,18+,19+,20-,21+/m1/s1 |
| InChIKey | RITOINUTGUCQPS-BMFSAJMZSA-N |
| XLogP | 3.97 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |