C21H23FO4S — CID 138495537
(3aS,6S,7R,7aS)-7-[(4-fluorophenyl)methoxy]-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 138495537) has the molecular formula C21H23FO4S and a molecular weight of 390.48 g/mol. Its IUPAC name is (3aS,6S,7R,7aS)-7-[(4-fluorophenyl)methoxy]-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aS,6S,7R,7aS)-7-[(4-fluorophenyl)methoxy]-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 138495537 |
| Molecular Formula | C21H23FO4S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (3aS,6S,7R,7aS)-7-[(4-fluorophenyl)methoxy]-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | CC1(C)O[C@@H]2[C@@H](OCc3ccc(F)cc3)[C@H](Sc3ccccc3)OC[C@@H]2O1 |
| InChI | InChI=1S/C21H23FO4S/c1-21(2)25-17-13-24-20(27-16-6-4-3-5-7-16)19(18(17)26-21)23-12-14-8-10-15(22)11-9-14/h3-11,17-20H,12-13H2,1-2H3/t17-,18-,19+,20-/m0/s1 |
| InChIKey | DMCPSPVEGDOWES-HAGHYFMRSA-N |
| XLogP | 4.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |