C14H13F2N3O2 — CID 138495571
N-[5-[5-(3,3-difluorocyclobutyl)-1,3,4-oxadiazol-2-yl]-2-methylphenyl]formamide (PubChem CID 138495571) has the molecular formula C14H13F2N3O2 and a molecular weight of 293.27 g/mol. Its IUPAC name is N-[5-[5-(3,3-difluorocyclobutyl)-1,3,4-oxadiazol-2-yl]-2-methylphenyl]formamide.
| Compound Name | N-[5-[5-(3,3-difluorocyclobutyl)-1,3,4-oxadiazol-2-yl]-2-methylphenyl]formamide |
|---|---|
| PubChem CID | 138495571 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[5-[5-(3,3-difluorocyclobutyl)-1,3,4-oxadiazol-2-yl]-2-methylphenyl]formamide |
| SMILES | Cc1ccc(-c2nnc(C3CC(F)(F)C3)o2)cc1NC=O |
| InChI | InChI=1S/C14H13F2N3O2/c1-8-2-3-9(4-11(8)17-7-20)12-18-19-13(21-12)10-5-14(15,16)6-10/h2-4,7,10H,5-6H2,1H3,(H,17,20) |
| InChIKey | BWEAUCXLOZHYCN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|